C17H19Cl3N4O2S — CID 41237004
N,N-diethyl-6-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]pyridine-3-sulfonamide (PubChem CID 41237004) has the molecular formula C17H19Cl3N4O2S and a molecular weight of 449.79 g/mol. Its IUPAC name is N,N-diethyl-6-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 41237004 |
| Molecular Formula | C17H19Cl3N4O2S |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | N,N-diethyl-6-[(2Z)-2-[1-(2,3,4-trichlorophenyl)ethylidene]hydrazinyl]pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C(/C)c2ccc(Cl)c(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C17H19Cl3N4O2S/c1-4-24(5-2)27(25,26)12-6-9-15(21-10-12)23-22-11(3)13-7-8-14(18)17(20)16(13)19/h6-10H,4-5H2,1-3H3,(H,21,23)/b22-11- |
| InChIKey | FGTGXSIDKXONLN-JJFYIABZSA-N |
| XLogP | 4.91 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|