C20H26N4O4S — CID 16556231
6-[(2E)-2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide (PubChem CID 16556231) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is 6-[(2E)-2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide.
| Compound Name | 6-[(2E)-2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 16556231 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-[(2E)-2-[4-(1,3-benzodioxol-5-yl)butan-2-ylidene]hydrazinyl]-N,N-diethylpyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N/N=C(\C)CCc2ccc3c(c2)OCO3)nc1 |
| InChI | InChI=1S/C20H26N4O4S/c1-4-24(5-2)29(25,26)17-9-11-20(21-13-17)23-22-15(3)6-7-16-8-10-18-19(12-16)28-14-27-18/h8-13H,4-7,14H2,1-3H3,(H,21,23)/b22-15+ |
| InChIKey | ZLAOXIXAJMPGQI-PXLXIMEGSA-N |
| XLogP | 3.26 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|