C17H23N3O2S — CID 5267715
N,N-diethyl-6-(4-ethylanilino)pyridine-3-sulfonamide (PubChem CID 5267715) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N,N-diethyl-6-(4-ethylanilino)pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-(4-ethylanilino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267715 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N,N-diethyl-6-(4-ethylanilino)pyridine-3-sulfonamide |
| SMILES | CCc1ccc(Nc2ccc(S(=O)(=O)N(CC)CC)cn2)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-14-7-9-15(10-8-14)19-17-12-11-16(13-18-17)23(21,22)20(5-2)6-3/h7-13H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | IFMLFQSJTMTZGQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |