C15H18IN3O2S — CID 5267788
N,N-diethyl-6-(4-iodoanilino)pyridine-3-sulfonamide (PubChem CID 5267788) has the molecular formula C15H18IN3O2S and a molecular weight of 431.30 g/mol. Its IUPAC name is N,N-diethyl-6-(4-iodoanilino)pyridine-3-sulfonamide.
| Compound Name | N,N-diethyl-6-(4-iodoanilino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267788 |
| Molecular Formula | C15H18IN3O2S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N,N-diethyl-6-(4-iodoanilino)pyridine-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ccc(I)cc2)nc1 |
| InChI | InChI=1S/C15H18IN3O2S/c1-3-19(4-2)22(20,21)14-9-10-15(17-11-14)18-13-7-5-12(16)6-8-13/h5-11H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | ZXTFUIFGNZFGJA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|