C15H17N3O3S — CID 5267682
6-(4-acetylanilino)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 5267682) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 6-(4-acetylanilino)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(4-acetylanilino)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267682 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 6-(4-acetylanilino)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CC(=O)c1ccc(Nc2ccc(S(=O)(=O)N(C)C)cn2)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c1-11(19)12-4-6-13(7-5-12)17-15-9-8-14(10-16-15)22(20,21)18(2)3/h4-10H,1-3H3,(H,16,17) |
| InChIKey | BZWYXZDMRHWIEW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |