C18H24N4O3S — CID 113030001
N-[5-(tert-butylamino)-2-pyridinyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 113030001) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[5-(tert-butylamino)-2-pyridinyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[5-(tert-butylamino)-2-pyridinyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 113030001 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[5-(tert-butylamino)-2-pyridinyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(NC(C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-18(2,3)21-14-8-11-16(19-12-14)20-17(23)13-6-9-15(10-7-13)26(24,25)22(4)5/h6-12,21H,1-5H3,(H,19,20,23) |
| InChIKey | MMWPZBCLJABSRW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |