C18H24N4O4S — CID 113010487
4-(dimethylsulfamoyl)-N-[6-(3-methoxypropylamino)-3-pyridinyl]benzamide (PubChem CID 113010487) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[6-(3-methoxypropylamino)-3-pyridinyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[6-(3-methoxypropylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113010487 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[6-(3-methoxypropylamino)-3-pyridinyl]benzamide |
| SMILES | COCCCNc1ccc(NC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)cn1 |
| InChI | InChI=1S/C18H24N4O4S/c1-22(2)27(24,25)16-8-5-14(6-9-16)18(23)21-15-7-10-17(20-13-15)19-11-4-12-26-3/h5-10,13H,4,11-12H2,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | ZTTSJENTMQIFLJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|