C20H28N4O2 — CID 109153224
N-[4-(diethylamino)phenyl]-6-(3-methoxypropylamino)pyridine-3-carboxamide (PubChem CID 109153224) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-6-(3-methoxypropylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-6-(3-methoxypropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109153224 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-6-(3-methoxypropylamino)pyridine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(NCCCOC)nc2)cc1 |
| InChI | InChI=1S/C20H28N4O2/c1-4-24(5-2)18-10-8-17(9-11-18)23-20(25)16-7-12-19(22-15-16)21-13-6-14-26-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | HNVCBAFPGHTMBQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|