C18H22N4O3 — CID 109153217
N-(4-acetamidophenyl)-6-(3-methoxypropylamino)pyridine-3-carboxamide (PubChem CID 109153217) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-6-(3-methoxypropylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-6-(3-methoxypropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109153217 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(4-acetamidophenyl)-6-(3-methoxypropylamino)pyridine-3-carboxamide |
| SMILES | COCCCNc1ccc(C(=O)Nc2ccc(NC(C)=O)cc2)cn1 |
| InChI | InChI=1S/C18H22N4O3/c1-13(23)21-15-5-7-16(8-6-15)22-18(24)14-4-9-17(20-12-14)19-10-3-11-25-2/h4-9,12H,3,10-11H2,1-2H3,(H,19,20)(H,21,23)(H,22,24) |
| InChIKey | RTJMBIOOAYJLBX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|