C21H29N3O — CID 109161313
N-(4-tert-butylphenyl)-6-(pentylamino)pyridine-3-carboxamide (PubChem CID 109161313) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-6-(pentylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-6-(pentylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161313 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-(4-tert-butylphenyl)-6-(pentylamino)pyridine-3-carboxamide |
| SMILES | CCCCCNc1ccc(C(=O)Nc2ccc(C(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C21H29N3O/c1-5-6-7-14-22-19-13-8-16(15-23-19)20(25)24-18-11-9-17(10-12-18)21(2,3)4/h8-13,15H,5-7,14H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | LTAJDYQYUJNHDF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|