C18H21N3O3 — CID 109167267
N-(4-acetylphenyl)-2-(3-methoxypropylamino)pyridine-4-carboxamide (PubChem CID 109167267) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(3-methoxypropylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-acetylphenyl)-2-(3-methoxypropylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109167267 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-(4-acetylphenyl)-2-(3-methoxypropylamino)pyridine-4-carboxamide |
| SMILES | COCCCNc1cc(C(=O)Nc2ccc(C(C)=O)cc2)ccn1 |
| InChI | InChI=1S/C18H21N3O3/c1-13(22)14-4-6-16(7-5-14)21-18(23)15-8-10-20-17(12-15)19-9-3-11-24-2/h4-8,10,12H,3,9,11H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | NBVJCEQQIZNLGT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|