C18H23N3O3 — CID 109165609
2-(butylamino)-N-(3,4-dimethoxyphenyl)pyridine-4-carboxamide (PubChem CID 109165609) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-(butylamino)-N-(3,4-dimethoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(butylamino)-N-(3,4-dimethoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109165609 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-(butylamino)-N-(3,4-dimethoxyphenyl)pyridine-4-carboxamide |
| SMILES | CCCCNc1cc(C(=O)Nc2ccc(OC)c(OC)c2)ccn1 |
| InChI | InChI=1S/C18H23N3O3/c1-4-5-9-19-17-11-13(8-10-20-17)18(22)21-14-6-7-15(23-2)16(12-14)24-3/h6-8,10-12H,4-5,9H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | ZQUYNWAZQHJPIO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|