C14H16N4O3S2 — CID 42172358
4-(dimethylsulfamoyl)-N-(6-methylsulfanylpyridazin-3-yl)benzamide (PubChem CID 42172358) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(6-methylsulfanylpyridazin-3-yl)benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(6-methylsulfanylpyridazin-3-yl)benzamide |
|---|---|
| PubChem CID | 42172358 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(6-methylsulfanylpyridazin-3-yl)benzamide |
| SMILES | CSc1ccc(NC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)nn1 |
| InChI | InChI=1S/C14H16N4O3S2/c1-18(2)23(20,21)11-6-4-10(5-7-11)14(19)15-12-8-9-13(22-3)17-16-12/h4-9H,1-3H3,(H,15,16,19) |
| InChIKey | AYPAJBMDFQAGCE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |