C16H15N2O5S- — CID 6978549
4-[[4-(dimethylsulfamoyl)benzoyl]amino]benzoate (PubChem CID 6978549) has the molecular formula C16H15N2O5S- and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[[4-(dimethylsulfamoyl)benzoyl]amino]benzoate.
| Compound Name | 4-[[4-(dimethylsulfamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 6978549 |
| Molecular Formula | C16H15N2O5S- |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-[[4-(dimethylsulfamoyl)benzoyl]amino]benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c1-18(2)24(22,23)14-9-5-11(6-10-14)15(19)17-13-7-3-12(4-8-13)16(20)21/h3-10H,1-2H3,(H,17,19)(H,20,21)/p-1 |
| InChIKey | YRYAIMQCWMNAGU-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |