C16H18N4O4S — CID 33152473
N-[4-(carbamoylamino)phenyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 33152473) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 33152473 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(NC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C16H18N4O4S/c1-20(2)25(23,24)14-9-3-11(4-10-14)15(21)18-12-5-7-13(8-6-12)19-16(17)22/h3-10H,1-2H3,(H,18,21)(H3,17,19,22) |
| InChIKey | KRBKJCPHVHDDPU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |