C21H19F2N3O5S2 — CID 24636547
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 24636547) has the molecular formula C21H19F2N3O5S2 and a molecular weight of 495.53 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24636547 |
| Molecular Formula | C21H19F2N3O5S2 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(NS(=O)(=O)c3ccc(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C21H19F2N3O5S2/c1-26(2)33(30,31)17-9-3-14(4-10-17)21(27)24-15-5-7-16(8-6-15)25-32(28,29)18-11-12-19(22)20(23)13-18/h3-13,25H,1-2H3,(H,24,27) |
| InChIKey | IUMYNQNMPPKEGX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |