C14H12F2N2O3S — CID 25335198
4-[(3,4-difluorophenyl)sulfonylamino]-N-methylbenzamide (PubChem CID 25335198) has the molecular formula C14H12F2N2O3S and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfonylamino]-N-methylbenzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 25335198 |
| Molecular Formula | C14H12F2N2O3S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H12F2N2O3S/c1-17-14(19)9-2-4-10(5-3-9)18-22(20,21)11-6-7-12(15)13(16)8-11/h2-8,18H,1H3,(H,17,19) |
| InChIKey | WFRLYALGRXLOBU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |