C18H15F2N3O4S — CID 49396412
4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide (PubChem CID 49396412) has the molecular formula C18H15F2N3O4S and a molecular weight of 407.40 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 49396412 |
| Molecular Formula | C18H15F2N3O4S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-oxo-2-(prop-2-ynylamino)ethyl]benzamide |
| SMILES | C#CCNC(=O)CNC(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H15F2N3O4S/c1-2-9-21-17(24)11-22-18(25)12-3-5-13(6-4-12)23-28(26,27)14-7-8-15(19)16(20)10-14/h1,3-8,10,23H,9,11H2,(H,21,24)(H,22,25) |
| InChIKey | VBHAGHLIQAFORG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|