C21H17F3N2O3S — CID 27256677
4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-fluorophenyl)ethyl]benzamide (PubChem CID 27256677) has the molecular formula C21H17F3N2O3S and a molecular weight of 434.44 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-fluorophenyl)ethyl]benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-fluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 27256677 |
| Molecular Formula | C21H17F3N2O3S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfonylamino]-N-[2-(4-fluorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C21H17F3N2O3S/c22-16-5-1-14(2-6-16)11-12-25-21(27)15-3-7-17(8-4-15)26-30(28,29)18-9-10-19(23)20(24)13-18/h1-10,13,26H,11-12H2,(H,25,27) |
| InChIKey | QKKBNQJTJPBEMJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |