C21H18FN3O6S — CID 16960874
N-[2-(4-fluorophenyl)ethyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 16960874) has the molecular formula C21H18FN3O6S and a molecular weight of 459.46 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 16960874 |
| Molecular Formula | C21H18FN3O6S |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc(NS(=O)(=O)c2ccc(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H18FN3O6S/c22-16-5-1-14(2-6-16)11-12-23-21(27)15-3-7-17(8-4-15)24-32(30,31)18-9-10-20(26)19(13-18)25(28)29/h1-10,13,24,26H,11-12H2,(H,23,27) |
| InChIKey | SLWUCMWUFHPOSK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|