C22H20FN3O7S — CID 16961078
N-[(3-fluoro-4-methoxyphenyl)methyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-methylbenzamide (PubChem CID 16961078) has the molecular formula C22H20FN3O7S and a molecular weight of 489.48 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-methylbenzamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 16961078 |
| Molecular Formula | C22H20FN3O7S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-4-[(4-hydroxy-3-nitrophenyl)sulfonylamino]-N-methylbenzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc(NS(=O)(=O)c3ccc(O)c([N+](=O)[O-])c3)cc2)cc1F |
| InChI | InChI=1S/C22H20FN3O7S/c1-25(13-14-3-10-21(33-2)18(23)11-14)22(28)15-4-6-16(7-5-15)24-34(31,32)17-8-9-20(27)19(12-17)26(29)30/h3-12,24,27H,13H2,1-2H3 |
| InChIKey | FJZSOHFIEYMCPD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|