C24H25N3O8S — CID 4854406
N-methyl-4-[(3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide (PubChem CID 4854406) has the molecular formula C24H25N3O8S and a molecular weight of 515.54 g/mol. Its IUPAC name is N-methyl-4-[(3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide.
| Compound Name | N-methyl-4-[(3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 4854406 |
| Molecular Formula | C24H25N3O8S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | N-methyl-4-[(3-nitrophenyl)sulfonylamino]-N-[(2,3,4-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C24H25N3O8S/c1-26(15-17-10-13-21(33-2)23(35-4)22(17)34-3)24(28)16-8-11-18(12-9-16)25-36(31,32)20-7-5-6-19(14-20)27(29)30/h5-14,25H,15H2,1-4H3 |
| InChIKey | MKNOBVARGQYENE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|