C17H18N2O9S — CID 2961091
methyl 3,4,5-trimethoxy-2-[(3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 2961091) has the molecular formula C17H18N2O9S and a molecular weight of 426.40 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxy-2-[(3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | methyl 3,4,5-trimethoxy-2-[(3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2961091 |
| Molecular Formula | C17H18N2O9S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | methyl 3,4,5-trimethoxy-2-[(3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18N2O9S/c1-25-13-9-12(17(20)28-4)14(16(27-3)15(13)26-2)18-29(23,24)11-7-5-6-10(8-11)19(21)22/h5-9,18H,1-4H3 |
| InChIKey | HDZWWLYMMCVYPD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|