C23H21N5O7S — CID 3333042
3-nitro-N-[3-(3,4,5-trimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 3333042) has the molecular formula C23H21N5O7S and a molecular weight of 511.52 g/mol. Its IUPAC name is 3-nitro-N-[3-(3,4,5-trimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[3-(3,4,5-trimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3333042 |
| Molecular Formula | C23H21N5O7S |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 3-nitro-N-[3-(3,4,5-trimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N5O7S/c1-33-19-11-14(12-20(34-2)21(19)35-3)24-22-23(26-18-10-5-4-9-17(18)25-22)27-36(31,32)16-8-6-7-15(13-16)28(29)30/h4-13H,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | FEIAJJXXEUGLOT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|