C22H19ClN4O4S — CID 1413527
3-chloro-N-[3-(3,4-dimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 1413527) has the molecular formula C22H19ClN4O4S and a molecular weight of 470.94 g/mol. Its IUPAC name is 3-chloro-N-[3-(3,4-dimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[3-(3,4-dimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1413527 |
| Molecular Formula | C22H19ClN4O4S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-chloro-N-[3-(3,4-dimethoxyanilino)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C22H19ClN4O4S/c1-30-19-11-10-15(13-20(19)31-2)24-21-22(26-18-9-4-3-8-17(18)25-21)27-32(28,29)16-7-5-6-14(23)12-16/h3-13H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | XLMUNOIAPWUOIN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |