C21H15ClN4O4S — CID 1401039
3-[[3-[(3-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoic acid (PubChem CID 1401039) has the molecular formula C21H15ClN4O4S and a molecular weight of 454.90 g/mol. Its IUPAC name is 3-[[3-[(3-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[3-[(3-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 1401039 |
| Molecular Formula | C21H15ClN4O4S |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 3-[[3-[(3-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H15ClN4O4S/c22-14-6-4-8-16(12-14)31(29,30)26-20-19(24-17-9-1-2-10-18(17)25-20)23-15-7-3-5-13(11-15)21(27)28/h1-12H,(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | DVASZJRUKAMERG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |