C23H19ClN4O4S — CID 1402949
ethyl 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate (PubChem CID 1402949) has the molecular formula C23H19ClN4O4S and a molecular weight of 482.95 g/mol. Its IUPAC name is ethyl 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate.
| Compound Name | ethyl 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 1402949 |
| Molecular Formula | C23H19ClN4O4S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | ethyl 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H19ClN4O4S/c1-2-32-23(29)15-6-5-7-17(14-15)25-21-22(27-20-9-4-3-8-19(20)26-21)28-33(30,31)18-12-10-16(24)11-13-18/h3-14H,2H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | IDIQKSGHYPXZBE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |