C22H17N4O5S- — CID 2068807
3-[[3-[(4-methoxyphenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate (PubChem CID 2068807) has the molecular formula C22H17N4O5S- and a molecular weight of 449.47 g/mol. Its IUPAC name is 3-[[3-[(4-methoxyphenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate.
| Compound Name | 3-[[3-[(4-methoxyphenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 2068807 |
| Molecular Formula | C22H17N4O5S- |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 3-[[3-[(4-methoxyphenyl)sulfonylamino]quinoxalin-2-yl]amino]benzoate |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H18N4O5S/c1-31-16-9-11-17(12-10-16)32(29,30)26-21-20(24-18-7-2-3-8-19(18)25-21)23-15-6-4-5-14(13-15)22(27)28/h2-13H,1H3,(H,23,24)(H,25,26)(H,27,28)/p-1 |
| InChIKey | SMCUXBJQECRQAC-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |