C24H24N4O4S — CID 1402865
N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide (PubChem CID 1402865) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1402865 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(C)c(C)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-15-9-10-20(11-16(15)2)33(29,30)28-24-23(26-21-7-5-6-8-22(21)27-24)25-17-12-18(31-3)14-19(13-17)32-4/h5-14H,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | RVHHRAPXLSYARB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |