C24H24N4O2S — CID 1398671
N-[3-(4-ethylanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide (PubChem CID 1398671) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[3-(4-ethylanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(4-ethylanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1398671 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[3-(4-ethylanilino)quinoxalin-2-yl]-3,4-dimethylbenzenesulfonamide |
| SMILES | CCc1ccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-4-18-10-12-19(13-11-18)25-23-24(27-22-8-6-5-7-21(22)26-23)28-31(29,30)20-14-9-16(2)17(3)15-20/h5-15H,4H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | UMZODFSNKMJDSV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |