C25H27N5O4S2 — CID 2319111
N-[3-[4-(diethylsulfamoyl)anilino]quinoxalin-2-yl]-4-methylbenzenesulfonamide (PubChem CID 2319111) has the molecular formula C25H27N5O4S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is N-[3-[4-(diethylsulfamoyl)anilino]quinoxalin-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[4-(diethylsulfamoyl)anilino]quinoxalin-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2319111 |
| Molecular Formula | C25H27N5O4S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-[3-[4-(diethylsulfamoyl)anilino]quinoxalin-2-yl]-4-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H27N5O4S2/c1-4-30(5-2)36(33,34)21-16-12-19(13-17-21)26-24-25(28-23-9-7-6-8-22(23)27-24)29-35(31,32)20-14-10-18(3)11-15-20/h6-17H,4-5H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | RHEIUHGCIFVYIO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |