C20H24N4O2S — CID 3340734
4-methyl-N-[3-(pentylamino)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 3340734) has the molecular formula C20H24N4O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-methyl-N-[3-(pentylamino)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(pentylamino)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3340734 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-methyl-N-[3-(pentylamino)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | CCCCCNc1nc2ccccc2nc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H24N4O2S/c1-3-4-7-14-21-19-20(23-18-9-6-5-8-17(18)22-19)24-27(25,26)16-12-10-15(2)11-13-16/h5-6,8-13H,3-4,7,14H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | HPSLLHBFXYQKPL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|