C20H22N4O2S — CID 7456715
N-[3-(cyclopentylamino)quinoxalin-2-yl]-4-methylbenzenesulfonamide (PubChem CID 7456715) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[3-(cyclopentylamino)quinoxalin-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(cyclopentylamino)quinoxalin-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7456715 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[3-(cyclopentylamino)quinoxalin-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2NC2CCCC2)cc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-14-10-12-16(13-11-14)27(25,26)24-20-19(21-15-6-2-3-7-15)22-17-8-4-5-9-18(17)23-20/h4-5,8-13,15H,2-3,6-7H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | VOJKRQRUDVKJGZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |