C24H23N3O3S — CID 58373519
N-[3-[(2-ethoxyphenyl)methyl]quinoxalin-2-yl]-4-methylbenzenesulfonamide (PubChem CID 58373519) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[3-[(2-ethoxyphenyl)methyl]quinoxalin-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[(2-ethoxyphenyl)methyl]quinoxalin-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58373519 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[3-[(2-ethoxyphenyl)methyl]quinoxalin-2-yl]-4-methylbenzenesulfonamide |
| SMILES | CCOc1ccccc1Cc1nc2ccccc2nc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-3-30-23-11-7-4-8-18(23)16-22-24(26-21-10-6-5-9-20(21)25-22)27-31(28,29)19-14-12-17(2)13-15-19/h4-15H,3,16H2,1-2H3,(H,26,27) |
| InChIKey | OWMZFQPTWJSGRJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |