C23H22N4O2S — CID 1392277
3-methyl-N-[3-[(4-methylphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 1392277) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-methyl-N-[3-[(4-methylphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[3-[(4-methylphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1392277 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-methyl-N-[3-[(4-methylphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(CNc2nc3ccccc3nc2NS(=O)(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C23H22N4O2S/c1-16-10-12-18(13-11-16)15-24-22-23(26-21-9-4-3-8-20(21)25-22)27-30(28,29)19-7-5-6-17(2)14-19/h3-14H,15H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | SRJPFDRXSWWNQL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |