C22H20N4O3S — CID 2002654
N-[3-[(4-methoxyphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 2002654) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-[(4-methoxyphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2002654 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(CNc2nc3ccccc3nc2NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N4O3S/c1-29-17-13-11-16(12-14-17)15-23-21-22(25-20-10-6-5-9-19(20)24-21)26-30(27,28)18-7-3-2-4-8-18/h2-14H,15H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | KKBDXYJFEJJXPW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |