C22H17ClN4O4S — CID 20873702
4-[[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]methyl]benzoic acid (PubChem CID 20873702) has the molecular formula C22H17ClN4O4S and a molecular weight of 468.92 g/mol. Its IUPAC name is 4-[[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 20873702 |
| Molecular Formula | C22H17ClN4O4S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 4-[[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNc2nc3ccccc3nc2NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17ClN4O4S/c23-16-9-11-17(12-10-16)32(30,31)27-21-20(25-18-3-1-2-4-19(18)26-21)24-13-14-5-7-15(8-6-14)22(28)29/h1-12H,13H2,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | FWAFXWNXNIWOIJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |