C21H16BrFN4O2S — CID 25045627
4-bromo-N-[3-[(4-fluorophenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 25045627) has the molecular formula C21H16BrFN4O2S and a molecular weight of 487.35 g/mol. Its IUPAC name is 4-bromo-N-[3-[(4-fluorophenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[3-[(4-fluorophenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25045627 |
| Molecular Formula | C21H16BrFN4O2S |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 4-bromo-N-[3-[(4-fluorophenyl)methylamino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1NCc1ccc(F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16BrFN4O2S/c22-15-7-11-17(12-8-15)30(28,29)27-21-20(24-13-14-5-9-16(23)10-6-14)25-18-3-1-2-4-19(18)26-21/h1-12H,13H2,(H,24,25)(H,26,27) |
| InChIKey | OIXZFWIREUIASB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |