C19H23ClN5O2S+ — CID 8833941
3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]propyl-dimethylazanium (PubChem CID 8833941) has the molecular formula C19H23ClN5O2S+ and a molecular weight of 420.95 g/mol. Its IUPAC name is 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8833941 |
| Molecular Formula | C19H23ClN5O2S+ |
| Molecular Weight | 420.95 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-[[3-[(4-chlorophenyl)sulfonylamino]quinoxalin-2-yl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNc1nc2ccccc2nc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN5O2S/c1-25(2)13-5-12-21-18-19(23-17-7-4-3-6-16(17)22-18)24-28(26,27)15-10-8-14(20)9-11-15/h3-4,6-11H,5,12-13H2,1-2H3,(H,21,22)(H,23,24)/p+1 |
| InChIKey | WUXGNCNPLJOXLT-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.95 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|