C22H19ClN4O2S — CID 25040610
4-chloro-N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 25040610) has the molecular formula C22H19ClN4O2S and a molecular weight of 438.94 g/mol. Its IUPAC name is 4-chloro-N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25040610 |
| Molecular Formula | C22H19ClN4O2S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-chloro-N-[3-(2,5-dimethylanilino)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H19ClN4O2S/c1-14-7-8-15(2)20(13-14)26-21-22(25-19-6-4-3-5-18(19)24-21)27-30(28,29)17-11-9-16(23)10-12-17/h3-13H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | UTGVXNQIYIPFLC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |