C20H15ClN4O3S — CID 1024035
4-chloro-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 1024035) has the molecular formula C20H15ClN4O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is 4-chloro-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1024035 |
| Molecular Formula | C20H15ClN4O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 4-chloro-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1cccc(O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN4O3S/c21-13-8-10-16(11-9-13)29(27,28)25-20-19(22-14-4-3-5-15(26)12-14)23-17-6-1-2-7-18(17)24-20/h1-12,26H,(H,22,23)(H,24,25) |
| InChIKey | QCYHKBURZWATKM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |