C18H13BrN4O3S2 — CID 2443953
5-bromo-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2443953) has the molecular formula C18H13BrN4O3S2 and a molecular weight of 477.37 g/mol. Its IUPAC name is 5-bromo-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2443953 |
| Molecular Formula | C18H13BrN4O3S2 |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | 5-bromo-N-[3-(3-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1cccc(O)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C18H13BrN4O3S2/c19-15-8-9-16(27-15)28(25,26)23-18-17(20-11-4-3-5-12(24)10-11)21-13-6-1-2-7-14(13)22-18/h1-10,24H,(H,20,21)(H,22,23) |
| InChIKey | TWRXBZGFKGVFMH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |