C18H13ClN4O3S2 — CID 2444182
5-chloro-N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2444182) has the molecular formula C18H13ClN4O3S2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 5-chloro-N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2444182 |
| Molecular Formula | C18H13ClN4O3S2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 5-chloro-N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1ccc(O)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H13ClN4O3S2/c19-15-9-10-16(27-15)28(25,26)23-18-17(20-11-5-7-12(24)8-6-11)21-13-3-1-2-4-14(13)22-18/h1-10,24H,(H,20,21)(H,22,23) |
| InChIKey | JEZZLPRMPRHBPW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|