C11H7ClN2O2S3 — CID 893880
N-(1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide (PubChem CID 893880) has the molecular formula C11H7ClN2O2S3 and a molecular weight of 330.84 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 893880 |
| Molecular Formula | C11H7ClN2O2S3 |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H7ClN2O2S3/c12-9-5-6-10(18-9)19(15,16)14-11-13-7-3-1-2-4-8(7)17-11/h1-6H,(H,13,14) |
| InChIKey | ROKZYXRZNANQRQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |