C13H10FN3O2S2 — CID 60986077
2-amino-N-(1,3-benzothiazol-2-yl)-5-fluorobenzenesulfonamide (PubChem CID 60986077) has the molecular formula C13H10FN3O2S2 and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzothiazol-2-yl)-5-fluorobenzenesulfonamide.
| Compound Name | 2-amino-N-(1,3-benzothiazol-2-yl)-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60986077 |
| Molecular Formula | C13H10FN3O2S2 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-amino-N-(1,3-benzothiazol-2-yl)-5-fluorobenzenesulfonamide |
| SMILES | Nc1ccc(F)cc1S(=O)(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H10FN3O2S2/c14-8-5-6-9(15)12(7-8)21(18,19)17-13-16-10-3-1-2-4-11(10)20-13/h1-7H,15H2,(H,16,17) |
| InChIKey | CVFZAVDWFOMMMI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|