C19H12FN3O5S2 — CID 89047357
N-(1,3-benzothiazol-2-yl)-2-(2-fluoro-4-nitrophenoxy)benzenesulfonamide (PubChem CID 89047357) has the molecular formula C19H12FN3O5S2 and a molecular weight of 445.45 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2-fluoro-4-nitrophenoxy)benzenesulfonamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2-fluoro-4-nitrophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 89047357 |
| Molecular Formula | C19H12FN3O5S2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2-fluoro-4-nitrophenoxy)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccccc2S(=O)(=O)Nc2nc3ccccc3s2)c(F)c1 |
| InChI | InChI=1S/C19H12FN3O5S2/c20-13-11-12(23(24)25)9-10-15(13)28-16-6-2-4-8-18(16)30(26,27)22-19-21-14-5-1-3-7-17(14)29-19/h1-11H,(H,21,22) |
| InChIKey | ZSLPXGBJWZNZTO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|