C16H12FN3O3 — CID 141314832
5-(2-fluoro-4-nitrophenoxy)-2,3-dimethylquinoxaline (PubChem CID 141314832) has the molecular formula C16H12FN3O3 and a molecular weight of 313.29 g/mol. Its IUPAC name is 5-(2-fluoro-4-nitrophenoxy)-2,3-dimethylquinoxaline.
| Compound Name | 5-(2-fluoro-4-nitrophenoxy)-2,3-dimethylquinoxaline |
|---|---|
| PubChem CID | 141314832 |
| Molecular Formula | C16H12FN3O3 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-(2-fluoro-4-nitrophenoxy)-2,3-dimethylquinoxaline |
| SMILES | Cc1nc2cccc(Oc3ccc([N+](=O)[O-])cc3F)c2nc1C |
| InChI | InChI=1S/C16H12FN3O3/c1-9-10(2)19-16-13(18-9)4-3-5-15(16)23-14-7-6-11(20(21)22)8-12(14)17/h3-8H,1-2H3 |
| InChIKey | QYFPGDRCDYUPOQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|