C17H13FN2O3 — CID 134392084
4-(2-fluoro-4-nitrophenoxy)-6,7-dimethylquinoline (PubChem CID 134392084) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is 4-(2-fluoro-4-nitrophenoxy)-6,7-dimethylquinoline.
| Compound Name | 4-(2-fluoro-4-nitrophenoxy)-6,7-dimethylquinoline |
|---|---|
| PubChem CID | 134392084 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-(2-fluoro-4-nitrophenoxy)-6,7-dimethylquinoline |
| SMILES | Cc1cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2cc1C |
| InChI | InChI=1S/C17H13FN2O3/c1-10-7-13-15(8-11(10)2)19-6-5-16(13)23-17-4-3-12(20(21)22)9-14(17)18/h3-9H,1-2H3 |
| InChIKey | KMHLHKPLZVIRAS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|