C16H15FN2O3S2 — CID 143171687
ethane;7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanylthieno[3,2-b]pyridine (PubChem CID 143171687) has the molecular formula C16H15FN2O3S2 and a molecular weight of 366.44 g/mol. Its IUPAC name is ethane;7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanylthieno[3,2-b]pyridine.
| Compound Name | ethane;7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 143171687 |
| Molecular Formula | C16H15FN2O3S2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | ethane;7-(2-fluoro-4-nitrophenoxy)-2-methylsulfanylthieno[3,2-b]pyridine |
| SMILES | CC.CSc1cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2s1 |
| InChI | InChI=1S/C14H9FN2O3S2.C2H6/c1-21-13-7-10-14(22-13)12(4-5-16-10)20-11-3-2-8(17(18)19)6-9(11)15;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | WYANMTFFWRHSSM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|