C25H21Cl2FN2O5S — CID 66649121
2-[3,4-bis(3-chloropropoxy)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine (PubChem CID 66649121) has the molecular formula C25H21Cl2FN2O5S and a molecular weight of 551.42 g/mol. Its IUPAC name is 2-[3,4-bis(3-chloropropoxy)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine.
| Compound Name | 2-[3,4-bis(3-chloropropoxy)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 66649121 |
| Molecular Formula | C25H21Cl2FN2O5S |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 2-[3,4-bis(3-chloropropoxy)phenyl]-7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cc(-c4ccc(OCCCCl)c(OCCCCl)c4)sc23)c(F)c1 |
| InChI | InChI=1S/C25H21Cl2FN2O5S/c26-8-1-11-33-21-5-3-16(13-23(21)34-12-2-9-27)24-15-19-25(36-24)22(7-10-29-19)35-20-6-4-17(30(31)32)14-18(20)28/h3-7,10,13-15H,1-2,8-9,11-12H2 |
| InChIKey | JEVALAROQNAXPQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|